C9H20O4 — CID 21325277
2-(2-hydroxypropoxy)propan-1-ol;propan-2-one (PubChem CID 21325277) has the molecular formula C9H20O4 and a molecular weight of 192.25 g/mol. Its IUPAC name is 2-(2-hydroxypropoxy)propan-1-ol;propan-2-one.
| Compound Name | 2-(2-hydroxypropoxy)propan-1-ol;propan-2-one |
|---|---|
| PubChem CID | 21325277 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-(2-hydroxypropoxy)propan-1-ol;propan-2-one |
| SMILES | CC(C)=O.CC(O)COC(C)CO |
| InChI | InChI=1S/C6H14O3.C3H6O/c1-5(8)4-9-6(2)3-7;1-3(2)4/h5-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | VBFALSJJAYABTO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |