C11H22O7 — CID 135332889
2-(2-hydroxypropoxy)propan-1-ol;pentanedioic acid (PubChem CID 135332889) has the molecular formula C11H22O7 and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-(2-hydroxypropoxy)propan-1-ol;pentanedioic acid.
| Compound Name | 2-(2-hydroxypropoxy)propan-1-ol;pentanedioic acid |
|---|---|
| PubChem CID | 135332889 |
| Molecular Formula | C11H22O7 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(2-hydroxypropoxy)propan-1-ol;pentanedioic acid |
| SMILES | CC(O)COC(C)CO.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C6H14O3.C5H8O4/c1-5(8)4-9-6(2)3-7;6-4(7)2-1-3-5(8)9/h5-8H,3-4H2,1-2H3;1-3H2,(H,6,7)(H,8,9) |
| InChIKey | JZGLLQYBQPJETP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |