C21H44O5 — CID 121268166
2-(2-hydroxypropoxy)propan-1-ol;pentadecanoic acid (PubChem CID 121268166) has the molecular formula C21H44O5 and a molecular weight of 376.58 g/mol. Its IUPAC name is 2-(2-hydroxypropoxy)propan-1-ol;pentadecanoic acid.
| Compound Name | 2-(2-hydroxypropoxy)propan-1-ol;pentadecanoic acid |
|---|---|
| PubChem CID | 121268166 |
| Molecular Formula | C21H44O5 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | 2-(2-hydroxypropoxy)propan-1-ol;pentadecanoic acid |
| SMILES | CC(O)COC(C)CO.CCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H30O2.C6H14O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17;1-5(8)4-9-6(2)3-7/h2-14H2,1H3,(H,16,17);5-8H,3-4H2,1-2H3 |
| InChIKey | MEBDIQKSOVTOCW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|