About 2-methylpropan-1-ol;octadecanoic acid
2-methylpropan-1-ol;octadecanoic acid (PubChem CID 88506925) has the molecular formula C22H46O3
and a molecular weight of 358.61 g/mol. Its IUPAC name is 2-methylpropan-1-ol;octadecanoic acid.
Molecular Properties
| Compound Name | 2-methylpropan-1-ol;octadecanoic acid |
| PubChem CID | 88506925 |
| Molecular Formula | C22H46O3 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.34 |
| IUPAC Name | 2-methylpropan-1-ol;octadecanoic acid |
| SMILES | CC(C)CO.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O2.C4H10O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4(2)3-5/h2-17H2,1H3,(H,19,20);4-5H,3H2,1-2H3 |
| InChIKey | COYSAPNCKROMLN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropan-1-ol;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-1-ol;octadecanoic acid?
The IUPAC name of 2-methylpropan-1-ol;octadecanoic acid (CID 88506925) is 2-methylpropan-1-ol;octadecanoic acid.
What is the SMILES notation for 2-methylpropan-1-ol;octadecanoic acid?
The canonical SMILES for 2-methylpropan-1-ol;octadecanoic acid is CC(C)CO.CCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of 2-methylpropan-1-ol;octadecanoic acid?
The InChIKey is COYSAPNCKROMLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C4H10O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4(2)3-5/h2-17H2,1H3,(H,19,20);4-5H,3H2,1-2H3.
What are the key properties of 2-methylpropan-1-ol;octadecanoic acid?
2-methylpropan-1-ol;octadecanoic acid has a molecular weight of 358.61 g/mol, XLogP of 6.97, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-1-ol;octadecanoic acid is sourced from PubChem (CID 88506925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).