C17H36O6 — CID 88717716
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;6-methylheptanoic acid (PubChem CID 88717716) has the molecular formula C17H36O6 and a molecular weight of 336.47 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;6-methylheptanoic acid.
| Compound Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;6-methylheptanoic acid |
|---|---|
| PubChem CID | 88717716 |
| Molecular Formula | C17H36O6 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;6-methylheptanoic acid |
| SMILES | CC(C)CCCCC(=O)O.CC(O)COC(C)COC(C)CO |
| InChI | InChI=1S/C9H20O4.C8H16O2/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-7(2)5-3-4-6-8(9)10/h7-11H,4-6H2,1-3H3;7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | RJZWCWJQTYCEHX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|