About 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid)
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid) (PubChem CID 162141314) has the molecular formula C21H44O10S3
and a molecular weight of 552.77 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid).
Molecular Properties
| Compound Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid) |
| PubChem CID | 162141314 |
| Molecular Formula | C21H44O10S3 |
| Molecular Weight | 552.77 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid) |
| SMILES | CC(O)COC(C)COC(C)CO.CC(S)CC(=O)O.CC(S)CC(=O)O.CC(S)CC(=O)O |
| InChI | InChI=1S/C9H20O4.3C4H8O2S/c1-7(11)5-12-9(3)6-13-8(2)4-10;3*1-3(7)2-4(5)6/h7-11H,4-6H2,1-3H3;3*3,7H,2H2,1H3,(H,5,6) |
| InChIKey | ZJYQKLDLTVMSEX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.77 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid)?
The IUPAC name of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid) (CID 162141314) is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid).
What is the SMILES notation for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid)?
The canonical SMILES for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid) is CC(O)COC(C)COC(C)CO.CC(S)CC(=O)O.CC(S)CC(=O)O.CC(S)CC(=O)O.
What is the InChIKey of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid)?
The InChIKey is ZJYQKLDLTVMSEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O4.3C4H8O2S/c1-7(11)5-12-9(3)6-13-8(2)4-10;3*1-3(7)2-4(5)6/h7-11H,4-6H2,1-3H3;3*3,7H,2H2,1H3,(H,5,6).
What are the key properties of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid)?
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid) has a molecular weight of 552.77 g/mol, XLogP of 2.51, 13 rotatable bonds, 8 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;tris(3-sulfanylbutanoic acid) is sourced from PubChem (CID 162141314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).