2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid

C17H26O8 — CID 159288501

IUPAC2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid
SMILESCC(O)COC(C)COC(C)CO.O=C(O)c1ccc(C(=O)O)cc1
InChIInChI=1S/C9H20O4.C8H6O4/c1-7(11)5-12-9(3)6-13-8(2)4-10;9-7(10)5-1-2-6(4-3-5)8(11)12/h7-11H,4-6H2,1-3H3;1-4H,(H,9,10)(H,11,12)
InChIKeyKZUUSUPZVYQDKF-UHFFFAOYSA-N
MW358.39 g/mol
LogP1.25
Rot. Bonds9

About 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid

2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid (PubChem CID 159288501) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid.

Molecular Properties

Compound Name2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid
PubChem CID159288501
Molecular FormulaC17H26O8
Molecular Weight358.39 g/mol
Exact Mass358.16
IUPAC Name2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid
SMILESCC(O)COC(C)COC(C)CO.O=C(O)c1ccc(C(=O)O)cc1
InChIInChI=1S/C9H20O4.C8H6O4/c1-7(11)5-12-9(3)6-13-8(2)4-10;9-7(10)5-1-2-6(4-3-5)8(11)12/h7-11H,4-6H2,1-3H3;1-4H,(H,9,10)(H,11,12)
InChIKeyKZUUSUPZVYQDKF-UHFFFAOYSA-N
XLogP1.25
TPSA133.52 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.39
LogP ≤ 51.25
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Analyze 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid?
The IUPAC name of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid (CID 159288501) is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid.
What is the SMILES notation for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid?
The canonical SMILES for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid is CC(O)COC(C)COC(C)CO.O=C(O)c1ccc(C(=O)O)cc1.
What is the InChIKey of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid?
The InChIKey is KZUUSUPZVYQDKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O4.C8H6O4/c1-7(11)5-12-9(3)6-13-8(2)4-10;9-7(10)5-1-2-6(4-3-5)8(11)12/h7-11H,4-6H2,1-3H3;1-4H,(H,9,10)(H,11,12).
What are the key properties of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid?
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid has a molecular weight of 358.39 g/mol, XLogP of 1.25, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid is sourced from PubChem (CID 159288501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).