C17H26O8 — CID 159288501
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid (PubChem CID 159288501) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid.
| Compound Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid |
|---|---|
| PubChem CID | 159288501 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;terephthalic acid |
| SMILES | CC(O)COC(C)COC(C)CO.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H20O4.C8H6O4/c1-7(11)5-12-9(3)6-13-8(2)4-10;9-7(10)5-1-2-6(4-3-5)8(11)12/h7-11H,4-6H2,1-3H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | KZUUSUPZVYQDKF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |