C13H20O6 — CID 57351297
2-hydroxybenzoic acid;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 57351297) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;2-(2-hydroxypropoxy)propan-1-ol.
| Compound Name | 2-hydroxybenzoic acid;2-(2-hydroxypropoxy)propan-1-ol |
|---|---|
| PubChem CID | 57351297 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-hydroxybenzoic acid;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | CC(O)COC(C)CO.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C7H6O3.C6H14O3/c8-6-4-2-1-3-5(6)7(9)10;1-5(8)4-9-6(2)3-7/h1-4,8H,(H,9,10);5-8H,3-4H2,1-2H3 |
| InChIKey | LABCWKLLHYSGJX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |