2-hydroxybenzoic acid;3-hydroxybutanoic acid

C11H14O6 — CID 159574969

IUPAC2-hydroxybenzoic acid;3-hydroxybutanoic acid
SMILESCC(O)CC(=O)O.O=C(O)c1ccccc1O
InChIInChI=1S/C7H6O3.C4H8O3/c8-6-4-2-1-3-5(6)7(9)10;1-3(5)2-4(6)7/h1-4,8H,(H,9,10);3,5H,2H2,1H3,(H,6,7)
InChIKeyMIHBNDZLFMJRRD-UHFFFAOYSA-N
MW242.23 g/mol
LogP0.93
Rot. Bonds3

About 2-hydroxybenzoic acid;3-hydroxybutanoic acid

2-hydroxybenzoic acid;3-hydroxybutanoic acid (PubChem CID 159574969) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;3-hydroxybutanoic acid.

Molecular Properties

Compound Name2-hydroxybenzoic acid;3-hydroxybutanoic acid
PubChem CID159574969
Molecular FormulaC11H14O6
Molecular Weight242.23 g/mol
Exact Mass242.08
IUPAC Name2-hydroxybenzoic acid;3-hydroxybutanoic acid
SMILESCC(O)CC(=O)O.O=C(O)c1ccccc1O
InChIInChI=1S/C7H6O3.C4H8O3/c8-6-4-2-1-3-5(6)7(9)10;1-3(5)2-4(6)7/h1-4,8H,(H,9,10);3,5H,2H2,1H3,(H,6,7)
InChIKeyMIHBNDZLFMJRRD-UHFFFAOYSA-N
XLogP0.93
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.23
LogP ≤ 50.93
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-hydroxybenzoic acid;3-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxybenzoic acid;3-hydroxybutanoic acid?
The IUPAC name of 2-hydroxybenzoic acid;3-hydroxybutanoic acid (CID 159574969) is 2-hydroxybenzoic acid;3-hydroxybutanoic acid.
What is the SMILES notation for 2-hydroxybenzoic acid;3-hydroxybutanoic acid?
The canonical SMILES for 2-hydroxybenzoic acid;3-hydroxybutanoic acid is CC(O)CC(=O)O.O=C(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzoic acid;3-hydroxybutanoic acid?
The InChIKey is MIHBNDZLFMJRRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C4H8O3/c8-6-4-2-1-3-5(6)7(9)10;1-3(5)2-4(6)7/h1-4,8H,(H,9,10);3,5H,2H2,1H3,(H,6,7).
What are the key properties of 2-hydroxybenzoic acid;3-hydroxybutanoic acid?
2-hydroxybenzoic acid;3-hydroxybutanoic acid has a molecular weight of 242.23 g/mol, XLogP of 0.93, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;3-hydroxybutanoic acid is sourced from PubChem (CID 159574969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).