C11H14O6 — CID 159574969
2-hydroxybenzoic acid;3-hydroxybutanoic acid (PubChem CID 159574969) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;3-hydroxybutanoic acid.
| Compound Name | 2-hydroxybenzoic acid;3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 159574969 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-hydroxybenzoic acid;3-hydroxybutanoic acid |
| SMILES | CC(O)CC(=O)O.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C7H6O3.C4H8O3/c8-6-4-2-1-3-5(6)7(9)10;1-3(5)2-4(6)7/h1-4,8H,(H,9,10);3,5H,2H2,1H3,(H,6,7) |
| InChIKey | MIHBNDZLFMJRRD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |