About 2-aminopropanoic acid;2-hydroxybenzoic acid
2-aminopropanoic acid;2-hydroxybenzoic acid (PubChem CID 175151085) has the molecular formula C10H13NO5
and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-aminopropanoic acid;2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 2-aminopropanoic acid;2-hydroxybenzoic acid |
| PubChem CID | 175151085 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-aminopropanoic acid;2-hydroxybenzoic acid |
| SMILES | CC(N)C(=O)O.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C7H6O3.C3H7NO2/c8-6-4-2-1-3-5(6)7(9)10;1-2(4)3(5)6/h1-4,8H,(H,9,10);2H,4H2,1H3,(H,5,6) |
| InChIKey | JMRXYZBETQYISB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminopropanoic acid;2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopropanoic acid;2-hydroxybenzoic acid?
The IUPAC name of 2-aminopropanoic acid;2-hydroxybenzoic acid (CID 175151085) is 2-aminopropanoic acid;2-hydroxybenzoic acid.
What is the SMILES notation for 2-aminopropanoic acid;2-hydroxybenzoic acid?
The canonical SMILES for 2-aminopropanoic acid;2-hydroxybenzoic acid is CC(N)C(=O)O.O=C(O)c1ccccc1O.
What is the InChIKey of 2-aminopropanoic acid;2-hydroxybenzoic acid?
The InChIKey is JMRXYZBETQYISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C3H7NO2/c8-6-4-2-1-3-5(6)7(9)10;1-2(4)3(5)6/h1-4,8H,(H,9,10);2H,4H2,1H3,(H,5,6).
What are the key properties of 2-aminopropanoic acid;2-hydroxybenzoic acid?
2-aminopropanoic acid;2-hydroxybenzoic acid has a molecular weight of 227.22 g/mol, XLogP of 0.51, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopropanoic acid;2-hydroxybenzoic acid is sourced from PubChem (CID 175151085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).