2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid

C10H13NO6 — CID 70187376

IUPAC2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid
SMILESNC(CO)C(=O)O.O=C(O)c1ccccc1O
InChIInChI=1S/C7H6O3.C3H7NO3/c8-6-4-2-1-3-5(6)7(9)10;4-2(1-5)3(6)7/h1-4,8H,(H,9,10);2,5H,1,4H2,(H,6,7)
InChIKeyAKPRRYGYKIDVJO-UHFFFAOYSA-N
MW243.22 g/mol
LogP-0.52
Rot. Bonds3

About 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid

2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid (PubChem CID 70187376) has the molecular formula C10H13NO6 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid.

Molecular Properties

Compound Name2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid
PubChem CID70187376
Molecular FormulaC10H13NO6
Molecular Weight243.22 g/mol
Exact Mass243.07
IUPAC Name2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid
SMILESNC(CO)C(=O)O.O=C(O)c1ccccc1O
InChIInChI=1S/C7H6O3.C3H7NO3/c8-6-4-2-1-3-5(6)7(9)10;4-2(1-5)3(6)7/h1-4,8H,(H,9,10);2,5H,1,4H2,(H,6,7)
InChIKeyAKPRRYGYKIDVJO-UHFFFAOYSA-N
XLogP-0.52
TPSA141.08 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.22
LogP ≤ 5-0.52
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid
CID 157145146
(2S)-2-amino-4-sulfanylbutanoic acid;2-hydroxybenzoic acid
CID 158324886
2-aminopropanoic acid;2-hydroxybenzoic acid
CID 175151085
(2S)-2-amino-4-methylsulfanylbutanoic acid;2-hydroxybenzoic acid
CID 158995174
CID 87183669
CID 87183669
2-hydroxybenzoic acid;hydrobromide
CID 70122828
gadolinium;tris(2-hydroxybenzoic acid)
CID 135122115
chromium;2-hydroxybenzoic acid
CID 87079476
2-hydroxybenzoic acid;praseodymium
CID 87786006
2-hydroxybenzoic acid;bis(yttrium)
CID 20697161
bis(2-hydroxybenzoic acid);sulfane
CID 172742301
2-hydroxybenzoic acid;silver
CID 87326670

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid?
The IUPAC name of 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid (CID 70187376) is 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid.
What is the SMILES notation for 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid?
The canonical SMILES for 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid is NC(CO)C(=O)O.O=C(O)c1ccccc1O.
What is the InChIKey of 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid?
The InChIKey is AKPRRYGYKIDVJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C3H7NO3/c8-6-4-2-1-3-5(6)7(9)10;4-2(1-5)3(6)7/h1-4,8H,(H,9,10);2,5H,1,4H2,(H,6,7).
What are the key properties of 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid?
2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid has a molecular weight of 243.22 g/mol, XLogP of -0.52, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-hydroxypropanoic acid;2-hydroxybenzoic acid is sourced from PubChem (CID 70187376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).