C12H17NO5S — CID 158995174
(2S)-2-amino-4-methylsulfanylbutanoic acid;2-hydroxybenzoic acid (PubChem CID 158995174) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;2-hydroxybenzoic acid.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 158995174 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;2-hydroxybenzoic acid |
| SMILES | CSCC[C@H](N)C(=O)O.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C7H6O3.C5H11NO2S/c8-6-4-2-1-3-5(6)7(9)10;1-9-3-2-4(6)5(7)8/h1-4,8H,(H,9,10);4H,2-3,6H2,1H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | JQQPOQMWUDGVBF-VWMHFEHESA-N |
| XLogP | 1.24 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |