C12H19NO2S2 — CID 87560055
(2S)-2-amino-4-methylsulfanylbutanoic acid;phenylmethanethiol (PubChem CID 87560055) has the molecular formula C12H19NO2S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;phenylmethanethiol.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;phenylmethanethiol |
|---|---|
| PubChem CID | 87560055 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;phenylmethanethiol |
| SMILES | CSCC[C@H](N)C(=O)O.SCc1ccccc1 |
| InChI | InChI=1S/C7H8S.C5H11NO2S/c8-6-7-4-2-1-3-5-7;1-9-3-2-4(6)5(7)8/h1-5,8H,6H2;4H,2-3,6H2,1H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | ZHBATPUBAWRRSW-VWMHFEHESA-N |
| XLogP | 2.27 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|