C14H31N3O6S3 — CID 88879582
bis((2S)-2-amino-4-methylsulfanylbutanoic acid);(2S)-2-amino-4-sulfanylbutanoic acid (PubChem CID 88879582) has the molecular formula C14H31N3O6S3 and a molecular weight of 433.62 g/mol. Its IUPAC name is bis((2S)-2-amino-4-methylsulfanylbutanoic acid);(2S)-2-amino-4-sulfanylbutanoic acid.
| Compound Name | bis((2S)-2-amino-4-methylsulfanylbutanoic acid);(2S)-2-amino-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 88879582 |
| Molecular Formula | C14H31N3O6S3 |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | bis((2S)-2-amino-4-methylsulfanylbutanoic acid);(2S)-2-amino-4-sulfanylbutanoic acid |
| SMILES | CSCC[C@H](N)C(=O)O.CSCC[C@H](N)C(=O)O.N[C@@H](CCS)C(=O)O |
| InChI | InChI=1S/2C5H11NO2S.C4H9NO2S/c2*1-9-3-2-4(6)5(7)8;5-3(1-2-8)4(6)7/h2*4H,2-3,6H2,1H3,(H,7,8);3,8H,1-2,5H2,(H,6,7)/t2*4-;3-/m000/s1 |
| InChIKey | ZPJKDQJSCIMMGB-PSKQQMADSA-N |
| XLogP | 0.02 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|