About bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc
bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc (PubChem CID 132989209) has the molecular formula C10H22N2O4S2Zn
and a molecular weight of 363.82 g/mol. Its IUPAC name is bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc.
Molecular Properties
| Compound Name | bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc |
| PubChem CID | 132989209 |
| Molecular Formula | C10H22N2O4S2Zn |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc |
| SMILES | CSCC[C@H](N)C(=O)O.CSCC[C@H](N)C(=O)O.[Zn] |
| InChI | InChI=1S/2C5H11NO2S.Zn/c2*1-9-3-2-4(6)5(7)8;/h2*4H,2-3,6H2,1H3,(H,7,8);/t2*4-;/m00./s1 |
| InChIKey | XJIVIOIILMBTSP-SCGRZTRASA-N |
| XLogP | 0.30 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc?
The IUPAC name of bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc (CID 132989209) is bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc.
What is the SMILES notation for bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc?
The canonical SMILES for bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc is CSCC[C@H](N)C(=O)O.CSCC[C@H](N)C(=O)O.[Zn].
What is the InChIKey of bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc?
The InChIKey is XJIVIOIILMBTSP-SCGRZTRASA-N. The full InChI is InChI=1S/2C5H11NO2S.Zn/c2*1-9-3-2-4(6)5(7)8;/h2*4H,2-3,6H2,1H3,(H,7,8);/t2*4-;/m00./s1.
What are the key properties of bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc?
bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc has a molecular weight of 363.82 g/mol, XLogP of 0.30, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2S)-2-amino-4-methylsulfanylbutanoic acid);zinc is sourced from PubChem (CID 132989209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).