About (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde
(2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde (PubChem CID 161434008) has the molecular formula C6H13NO3S
and a molecular weight of 179.24 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde.
Molecular Properties
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde |
| PubChem CID | 161434008 |
| Molecular Formula | C6H13NO3S |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde |
| SMILES | C=O.CSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2S.CH2O/c1-9-3-2-4(6)5(7)8;1-2/h4H,2-3,6H2,1H3,(H,7,8);1H2/t4-;/m0./s1 |
| InChIKey | VYKBJKXWFLJOSC-WCCKRBBISA-N |
| XLogP | -0.03 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde?
The IUPAC name of (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde (CID 161434008) is (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde.
What is the SMILES notation for (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde?
The canonical SMILES for (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde is C=O.CSCC[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde?
The InChIKey is VYKBJKXWFLJOSC-WCCKRBBISA-N. The full InChI is InChI=1S/C5H11NO2S.CH2O/c1-9-3-2-4(6)5(7)8;1-2/h4H,2-3,6H2,1H3,(H,7,8);1H2/t4-;/m0./s1.
What are the key properties of (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde?
(2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde has a molecular weight of 179.24 g/mol, XLogP of -0.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-methylsulfanylbutanoic acid;formaldehyde is sourced from PubChem (CID 161434008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).