About 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate
2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate (PubChem CID 174389151) has the molecular formula C5H15NO3S2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate.
Molecular Properties
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate |
| PubChem CID | 174389151 |
| Molecular Formula | C5H15NO3S2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate |
| SMILES | CSCCC(N)C(=O)O.O.S |
| InChI | InChI=1S/C5H11NO2S.H2O.H2S/c1-9-3-2-4(6)5(7)8;;/h4H,2-3,6H2,1H3,(H,7,8);2*1H2 |
| InChIKey | ALOZTWQPRNFMAW-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate?
The IUPAC name of 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate (CID 174389151) is 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate.
What is the SMILES notation for 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate?
The canonical SMILES for 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate is CSCCC(N)C(=O)O.O.S.
What is the InChIKey of 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate?
The InChIKey is ALOZTWQPRNFMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2S.H2O.H2S/c1-9-3-2-4(6)5(7)8;;/h4H,2-3,6H2,1H3,(H,7,8);2*1H2.
What are the key properties of 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate?
2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate has a molecular weight of 201.31 g/mol, XLogP of -0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methylsulfanylbutanoic acid;sulfane;hydrate is sourced from PubChem (CID 174389151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).