About (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide
(2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide (PubChem CID 57348970) has the molecular formula C6H16BrNO2S2
and a molecular weight of 278.24 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide.
Molecular Properties
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide |
| PubChem CID | 57348970 |
| Molecular Formula | C6H16BrNO2S2 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide |
| SMILES | CSCC[C@H](N)C(=O)O.C[SH2+].[Br-] |
| InChI | InChI=1S/C5H11NO2S.CH4S.BrH/c1-9-3-2-4(6)5(7)8;1-2;/h4H,2-3,6H2,1H3,(H,7,8);2H,1H3;1H/t4-;;/m0../s1 |
| InChIKey | XBNDCCCUOMXUBH-FHNDMYTFSA-N |
| XLogP | -3.22 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide?
The IUPAC name of (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide (CID 57348970) is (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide.
What is the SMILES notation for (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide?
The canonical SMILES for (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide is CSCC[C@H](N)C(=O)O.C[SH2+].[Br-].
What is the InChIKey of (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide?
The InChIKey is XBNDCCCUOMXUBH-FHNDMYTFSA-N. The full InChI is InChI=1S/C5H11NO2S.CH4S.BrH/c1-9-3-2-4(6)5(7)8;1-2;/h4H,2-3,6H2,1H3,(H,7,8);2H,1H3;1H/t4-;;/m0../s1.
What are the key properties of (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide?
(2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide has a molecular weight of 278.24 g/mol, XLogP of -3.22, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-methylsulfanylbutanoic acid;methylsulfanium;bromide is sourced from PubChem (CID 57348970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).