C13H29N3O6S3 — CID 166790626
bis(2-amino-4-methylsulfanylbutanoic acid);2-amino-3-sulfanylpropanoic acid (PubChem CID 166790626) has the molecular formula C13H29N3O6S3 and a molecular weight of 419.59 g/mol. Its IUPAC name is bis(2-amino-4-methylsulfanylbutanoic acid);2-amino-3-sulfanylpropanoic acid.
| Compound Name | bis(2-amino-4-methylsulfanylbutanoic acid);2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 166790626 |
| Molecular Formula | C13H29N3O6S3 |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | bis(2-amino-4-methylsulfanylbutanoic acid);2-amino-3-sulfanylpropanoic acid |
| SMILES | CSCCC(N)C(=O)O.CSCCC(N)C(=O)O.NC(CS)C(=O)O |
| InChI | InChI=1S/2C5H11NO2S.C3H7NO2S/c2*1-9-3-2-4(6)5(7)8;4-2(1-7)3(5)6/h2*4H,2-3,6H2,1H3,(H,7,8);2,7H,1,4H2,(H,5,6) |
| InChIKey | ZSMNBVCJWNSYKB-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|