About (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide
(2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide (PubChem CID 122236767) has the molecular formula C6H16INO2S2
and a molecular weight of 325.24 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide.
Molecular Properties
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide |
| PubChem CID | 122236767 |
| Molecular Formula | C6H16INO2S2 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide |
| SMILES | CS.CSCC[C@H](N)C(=O)O.I |
| InChI | InChI=1S/C5H11NO2S.CH4S.HI/c1-9-3-2-4(6)5(7)8;1-2;/h4H,2-3,6H2,1H3,(H,7,8);2H,1H3;1H/t4-;;/m0../s1 |
| InChIKey | SLCAYUNSFRLPFS-FHNDMYTFSA-N |
| XLogP | 1.32 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide?
The IUPAC name of (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide (CID 122236767) is (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide.
What is the SMILES notation for (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide?
The canonical SMILES for (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide is CS.CSCC[C@H](N)C(=O)O.I.
What is the InChIKey of (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide?
The InChIKey is SLCAYUNSFRLPFS-FHNDMYTFSA-N. The full InChI is InChI=1S/C5H11NO2S.CH4S.HI/c1-9-3-2-4(6)5(7)8;1-2;/h4H,2-3,6H2,1H3,(H,7,8);2H,1H3;1H/t4-;;/m0../s1.
What are the key properties of (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide?
(2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide has a molecular weight of 325.24 g/mol, XLogP of 1.32, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-methylsulfanylbutanoic acid;methanethiol;hydroiodide is sourced from PubChem (CID 122236767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).