About bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin
bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin (PubChem CID 10531078) has the molecular formula C22H32N2O4S2Sn
and a molecular weight of 571.35 g/mol. Its IUPAC name is bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin.
Molecular Properties
| Compound Name | bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin |
| PubChem CID | 10531078 |
| Molecular Formula | C22H32N2O4S2Sn |
| Molecular Weight | 571.35 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin |
| SMILES | CSCCC(N)C(=O)O.CSCCC(N)C(=O)O.c1ccc([Sn]c2ccccc2)cc1 |
| InChI | InChI=1S/2C6H5.2C5H11NO2S.Sn/c2*1-2-4-6-5-3-1;2*1-9-3-2-4(6)5(7)8;/h2*1-5H;2*4H,2-3,6H2,1H3,(H,7,8); |
| InChIKey | LFFAVNWWWAUKML-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 571.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin?
The IUPAC name of bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin (CID 10531078) is bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin.
What is the SMILES notation for bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin?
The canonical SMILES for bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin is CSCCC(N)C(=O)O.CSCCC(N)C(=O)O.c1ccc([Sn]c2ccccc2)cc1.
What is the InChIKey of bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin?
The InChIKey is LFFAVNWWWAUKML-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5.2C5H11NO2S.Sn/c2*1-2-4-6-5-3-1;2*1-9-3-2-4(6)5(7)8;/h2*1-5H;2*4H,2-3,6H2,1H3,(H,7,8);.
What are the key properties of bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin?
bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin has a molecular weight of 571.35 g/mol, XLogP of 1.64, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-amino-4-methylsulfanylbutanoic acid);diphenyltin is sourced from PubChem (CID 10531078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).