About 2-chloroacetic acid;2-hydroxybenzoic acid
2-chloroacetic acid;2-hydroxybenzoic acid (PubChem CID 57351465) has the molecular formula C9H9ClO5
and a molecular weight of 232.62 g/mol. Its IUPAC name is 2-chloroacetic acid;2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 2-chloroacetic acid;2-hydroxybenzoic acid |
| PubChem CID | 57351465 |
| Molecular Formula | C9H9ClO5 |
| Molecular Weight | 232.62 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 2-chloroacetic acid;2-hydroxybenzoic acid |
| SMILES | O=C(O)CCl.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C7H6O3.C2H3ClO2/c8-6-4-2-1-3-5(6)7(9)10;3-1-2(4)5/h1-4,8H,(H,9,10);1H2,(H,4,5) |
| InChIKey | CZLTUICJGMXSLY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.62 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetic acid;2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetic acid;2-hydroxybenzoic acid?
The IUPAC name of 2-chloroacetic acid;2-hydroxybenzoic acid (CID 57351465) is 2-chloroacetic acid;2-hydroxybenzoic acid.
What is the SMILES notation for 2-chloroacetic acid;2-hydroxybenzoic acid?
The canonical SMILES for 2-chloroacetic acid;2-hydroxybenzoic acid is O=C(O)CCl.O=C(O)c1ccccc1O.
What is the InChIKey of 2-chloroacetic acid;2-hydroxybenzoic acid?
The InChIKey is CZLTUICJGMXSLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C2H3ClO2/c8-6-4-2-1-3-5(6)7(9)10;3-1-2(4)5/h1-4,8H,(H,9,10);1H2,(H,4,5).
What are the key properties of 2-chloroacetic acid;2-hydroxybenzoic acid?
2-chloroacetic acid;2-hydroxybenzoic acid has a molecular weight of 232.62 g/mol, XLogP of 1.40, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetic acid;2-hydroxybenzoic acid is sourced from PubChem (CID 57351465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).