chlorophosphane;2-hydroxybenzoic acid

C7H8ClO3P — CID 145286030

IUPACchlorophosphane;2-hydroxybenzoic acid
SMILESO=C(O)c1ccccc1O.PCl
InChIInChI=1S/C7H6O3.ClH2P/c8-6-4-2-1-3-5(6)7(9)10;1-2/h1-4,8H,(H,9,10);2H2
InChIKeyMPZKFWDOVDUEJZ-UHFFFAOYSA-N
MW206.56 g/mol
LogP2.11
Rot. Bonds1

About chlorophosphane;2-hydroxybenzoic acid

chlorophosphane;2-hydroxybenzoic acid (PubChem CID 145286030) has the molecular formula C7H8ClO3P and a molecular weight of 206.56 g/mol. Its IUPAC name is chlorophosphane;2-hydroxybenzoic acid.

Molecular Properties

Compound Namechlorophosphane;2-hydroxybenzoic acid
PubChem CID145286030
Molecular FormulaC7H8ClO3P
Molecular Weight206.56 g/mol
Exact Mass205.99
IUPAC Namechlorophosphane;2-hydroxybenzoic acid
SMILESO=C(O)c1ccccc1O.PCl
InChIInChI=1S/C7H6O3.ClH2P/c8-6-4-2-1-3-5(6)7(9)10;1-2/h1-4,8H,(H,9,10);2H2
InChIKeyMPZKFWDOVDUEJZ-UHFFFAOYSA-N
XLogP2.11
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.56
LogP ≤ 52.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze chlorophosphane;2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of chlorophosphane;2-hydroxybenzoic acid?
The IUPAC name of chlorophosphane;2-hydroxybenzoic acid (CID 145286030) is chlorophosphane;2-hydroxybenzoic acid.
What is the SMILES notation for chlorophosphane;2-hydroxybenzoic acid?
The canonical SMILES for chlorophosphane;2-hydroxybenzoic acid is O=C(O)c1ccccc1O.PCl.
What is the InChIKey of chlorophosphane;2-hydroxybenzoic acid?
The InChIKey is MPZKFWDOVDUEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.ClH2P/c8-6-4-2-1-3-5(6)7(9)10;1-2/h1-4,8H,(H,9,10);2H2.
What are the key properties of chlorophosphane;2-hydroxybenzoic acid?
chlorophosphane;2-hydroxybenzoic acid has a molecular weight of 206.56 g/mol, XLogP of 2.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorophosphane;2-hydroxybenzoic acid is sourced from PubChem (CID 145286030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).