About 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid
2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid (PubChem CID 70273337) has the molecular formula C15H14O6
and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid |
| PubChem CID | 70273337 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)Cc1ccccc1O.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C8H8O3.C7H6O3/c9-7-4-2-1-3-6(7)5-8(10)11;8-6-4-2-1-3-5(6)7(9)10/h1-4,9H,5H2,(H,10,11);1-4,8H,(H,9,10) |
| InChIKey | VWQGSDZXHWPTHJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid?
The IUPAC name of 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid (CID 70273337) is 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid.
What is the SMILES notation for 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid?
The canonical SMILES for 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid is O=C(O)Cc1ccccc1O.O=C(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid?
The InChIKey is VWQGSDZXHWPTHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C7H6O3/c9-7-4-2-1-3-6(7)5-8(10)11;8-6-4-2-1-3-5(6)7(9)10/h1-4,9H,5H2,(H,10,11);1-4,8H,(H,9,10).
What are the key properties of 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid?
2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid has a molecular weight of 290.27 g/mol, XLogP of 2.11, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;2-(2-hydroxyphenyl)acetic acid is sourced from PubChem (CID 70273337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).