C18H36O8 — CID 87252519
2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propan-1-ol;prop-2-enoic acid (PubChem CID 87252519) has the molecular formula C18H36O8 and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propan-1-ol;prop-2-enoic acid.
| Compound Name | 2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propan-1-ol;prop-2-enoic acid |
|---|---|
| PubChem CID | 87252519 |
| Molecular Formula | C18H36O8 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propan-1-ol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(O)COC(C)COC(C)COC(C)COC(C)CO |
| InChI | InChI=1S/C15H32O6.C3H4O2/c1-11(17)7-18-13(3)9-20-15(5)10-21-14(4)8-19-12(2)6-16;1-2-3(4)5/h11-17H,6-10H2,1-5H3;2H,1H2,(H,4,5) |
| InChIKey | CMFYFUADLDVJIH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|