C13H26O6 — CID 162118566
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;methyl prop-2-enoate (PubChem CID 162118566) has the molecular formula C13H26O6 and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;methyl prop-2-enoate.
| Compound Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;methyl prop-2-enoate |
|---|---|
| PubChem CID | 162118566 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.CC(O)COC(C)COC(C)CO |
| InChI | InChI=1S/C9H20O4.C4H6O2/c1-7(11)5-12-9(3)6-13-8(2)4-10;1-3-4(5)6-2/h7-11H,4-6H2,1-3H3;3H,1H2,2H3 |
| InChIKey | ZHCGBAHPGFWAKO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|