C15H28O6 — CID 21458421
2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propyl prop-2-enoate (PubChem CID 21458421) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propyl prop-2-enoate.
| Compound Name | 2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 21458421 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)OCC(C)OCC(C)OCC(C)O |
| InChI | InChI=1S/C15H28O6/c1-6-15(17)21-10-14(5)20-9-13(4)19-8-12(3)18-7-11(2)16/h6,11-14,16H,1,7-10H2,2-5H3 |
| InChIKey | AIVLDPZRYJCEPU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|