C21H32O9 — CID 138059610
2-[2,3-bis(1-prop-2-enoyloxypropan-2-yloxy)propoxy]propyl prop-2-enoate (PubChem CID 138059610) has the molecular formula C21H32O9 and a molecular weight of 428.48 g/mol. Its IUPAC name is 2-[2,3-bis(1-prop-2-enoyloxypropan-2-yloxy)propoxy]propyl prop-2-enoate.
| Compound Name | 2-[2,3-bis(1-prop-2-enoyloxypropan-2-yloxy)propoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 138059610 |
| Molecular Formula | C21H32O9 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[2,3-bis(1-prop-2-enoyloxypropan-2-yloxy)propoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)OCC(COC(C)COC(=O)C=C)OC(C)COC(=O)C=C |
| InChI | InChI=1S/C21H32O9/c1-7-19(22)27-10-15(4)25-13-18(30-17(6)12-29-21(24)9-3)14-26-16(5)11-28-20(23)8-2/h7-9,15-18H,1-3,10-14H2,4-6H3 |
| InChIKey | WXEBMVUWJKWAGK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|