C9H14O4 — CID 89014347
2-prop-2-enylperoxypropyl prop-2-enoate (PubChem CID 89014347) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-prop-2-enylperoxypropyl prop-2-enoate.
| Compound Name | 2-prop-2-enylperoxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 89014347 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-prop-2-enylperoxypropyl prop-2-enoate |
| SMILES | C=CCOOC(C)COC(=O)C=C |
| InChI | InChI=1S/C9H14O4/c1-4-6-12-13-8(3)7-11-9(10)5-2/h4-5,8H,1-2,6-7H2,3H3 |
| InChIKey | WWNRCVZAKXZQCV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|