C14H24O6 — CID 20675751
2-[[2-(hydroperoxymethyl)cyclohexyl]methylperoxy]propyl prop-2-enoate (PubChem CID 20675751) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-[[2-(hydroperoxymethyl)cyclohexyl]methylperoxy]propyl prop-2-enoate.
| Compound Name | 2-[[2-(hydroperoxymethyl)cyclohexyl]methylperoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 20675751 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-[[2-(hydroperoxymethyl)cyclohexyl]methylperoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)OOCC1CCCCC1COO |
| InChI | InChI=1S/C14H24O6/c1-3-14(15)17-8-11(2)20-19-10-13-7-5-4-6-12(13)9-18-16/h3,11-13,16H,1,4-10H2,2H3 |
| InChIKey | HXDICEHARBWRIH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|