C8H14O5 — CID 118433563
2-(2-hydroperoxypropoxy)ethyl prop-2-enoate (PubChem CID 118433563) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is 2-(2-hydroperoxypropoxy)ethyl prop-2-enoate.
| Compound Name | 2-(2-hydroperoxypropoxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 118433563 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2-(2-hydroperoxypropoxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCC(C)OO |
| InChI | InChI=1S/C8H14O5/c1-3-8(9)12-5-4-11-6-7(2)13-10/h3,7,10H,1,4-6H2,2H3 |
| InChIKey | CBHAADPRZJYKBL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|