C9H12O7 — CID 172861993
2-(2-prop-2-enoyloxyethoxymethyl)propanedioic acid (PubChem CID 172861993) has the molecular formula C9H12O7 and a molecular weight of 232.19 g/mol. Its IUPAC name is 2-(2-prop-2-enoyloxyethoxymethyl)propanedioic acid.
| Compound Name | 2-(2-prop-2-enoyloxyethoxymethyl)propanedioic acid |
|---|---|
| PubChem CID | 172861993 |
| Molecular Formula | C9H12O7 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-(2-prop-2-enoyloxyethoxymethyl)propanedioic acid |
| SMILES | C=CC(=O)OCCOCC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H12O7/c1-2-7(10)16-4-3-15-5-6(8(11)12)9(13)14/h2,6H,1,3-5H2,(H,11,12)(H,13,14) |
| InChIKey | ZLYYETPOTOZKDH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|