C9H14O6 — CID 20793408
3-(2-prop-2-enoyloxyethoxymethoxy)propanoic acid (PubChem CID 20793408) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is 3-(2-prop-2-enoyloxyethoxymethoxy)propanoic acid.
| Compound Name | 3-(2-prop-2-enoyloxyethoxymethoxy)propanoic acid |
|---|---|
| PubChem CID | 20793408 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 3-(2-prop-2-enoyloxyethoxymethoxy)propanoic acid |
| SMILES | C=CC(=O)OCCOCOCCC(=O)O |
| InChI | InChI=1S/C9H14O6/c1-2-9(12)15-6-5-14-7-13-4-3-8(10)11/h2H,1,3-7H2,(H,10,11) |
| InChIKey | SSEJOJBHSXENDV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|