C13H20O7 — CID 172811544
2-[2-(2-prop-2-enoyloxyethoxy)ethyl]hexanedioic acid (PubChem CID 172811544) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-[2-(2-prop-2-enoyloxyethoxy)ethyl]hexanedioic acid.
| Compound Name | 2-[2-(2-prop-2-enoyloxyethoxy)ethyl]hexanedioic acid |
|---|---|
| PubChem CID | 172811544 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-[2-(2-prop-2-enoyloxyethoxy)ethyl]hexanedioic acid |
| SMILES | C=CC(=O)OCCOCCC(CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H20O7/c1-2-12(16)20-9-8-19-7-6-10(13(17)18)4-3-5-11(14)15/h2,10H,1,3-9H2,(H,14,15)(H,17,18) |
| InChIKey | SFZKJSRMNOWOPS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|