C8H14O4 — CID 59345604
2-(3-hydroxypropoxy)ethyl prop-2-enoate (PubChem CID 59345604) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-(3-hydroxypropoxy)ethyl prop-2-enoate.
| Compound Name | 2-(3-hydroxypropoxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 59345604 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-(3-hydroxypropoxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCCO |
| InChI | InChI=1S/C8H14O4/c1-2-8(10)12-7-6-11-5-3-4-9/h2,9H,1,3-7H2 |
| InChIKey | KKGAMYLGVXMFDM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|