C11H19ClO6 — CID 161184072
carbonochloridic acid;2-(5-hydroxypentoxy)ethyl prop-2-enoate (PubChem CID 161184072) has the molecular formula C11H19ClO6 and a molecular weight of 282.72 g/mol. Its IUPAC name is carbonochloridic acid;2-(5-hydroxypentoxy)ethyl prop-2-enoate.
| Compound Name | carbonochloridic acid;2-(5-hydroxypentoxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 161184072 |
| Molecular Formula | C11H19ClO6 |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | carbonochloridic acid;2-(5-hydroxypentoxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCCCCO.O=C(O)Cl |
| InChI | InChI=1S/C10H18O4.CHClO2/c1-2-10(12)14-9-8-13-7-5-3-4-6-11;2-1(3)4/h2,11H,1,3-9H2;(H,3,4) |
| InChIKey | USVWLKRKCFKMSK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|