C23H36O12 — CID 90141069
3-[2-(2-carboxyethoxymethyl)-3-(3-prop-2-enoyloxypropoxy)-2-(3-prop-2-enoyloxypropoxymethyl)propoxy]propanoic acid (PubChem CID 90141069) has the molecular formula C23H36O12 and a molecular weight of 504.53 g/mol. Its IUPAC name is 3-[2-(2-carboxyethoxymethyl)-3-(3-prop-2-enoyloxypropoxy)-2-(3-prop-2-enoyloxypropoxymethyl)propoxy]propanoic acid.
| Compound Name | 3-[2-(2-carboxyethoxymethyl)-3-(3-prop-2-enoyloxypropoxy)-2-(3-prop-2-enoyloxypropoxymethyl)propoxy]propanoic acid |
|---|---|
| PubChem CID | 90141069 |
| Molecular Formula | C23H36O12 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 3-[2-(2-carboxyethoxymethyl)-3-(3-prop-2-enoyloxypropoxy)-2-(3-prop-2-enoyloxypropoxymethyl)propoxy]propanoic acid |
| SMILES | C=CC(=O)OCCCOCC(COCCCOC(=O)C=C)(COCCC(=O)O)COCCC(=O)O |
| InChI | InChI=1S/C23H36O12/c1-3-21(28)34-11-5-9-30-15-23(17-32-13-7-19(24)25,18-33-14-8-20(26)27)16-31-10-6-12-35-22(29)4-2/h3-4H,1-2,5-18H2,(H,24,25)(H,26,27) |
| InChIKey | VAOMUVWCFZPIPZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|