C46H66O18 — CID 58445533
[2,2-bis(prop-2-enoyloxymethyl)-3-[3-prop-2-enoyloxy-2-(4-prop-2-enoyloxybutoxymethyl)-2-(6-prop-2-enoyloxyhexanoyloxymethyl)propoxy]propyl] 6-(3-oxopent-4-enoxy)hexanoate (PubChem CID 58445533) has the molecular formula C46H66O18 and a molecular weight of 907.02 g/mol. Its IUPAC name is [2,2-bis(prop-2-enoyloxymethyl)-3-[3-prop-2-enoyloxy-2-(4-prop-2-enoyloxybutoxymethyl)-2-(6-prop-2-enoyloxyhexanoyloxymethyl)propoxy]propyl] 6-(3-oxopent-4-enoxy)hexanoate.
| Compound Name | [2,2-bis(prop-2-enoyloxymethyl)-3-[3-prop-2-enoyloxy-2-(4-prop-2-enoyloxybutoxymethyl)-2-(6-prop-2-enoyloxyhexanoyloxymethyl)propoxy]propyl] 6-(3-oxopent-4-enoxy)hexanoate |
|---|---|
| PubChem CID | 58445533 |
| Molecular Formula | C46H66O18 |
| Molecular Weight | 907.02 g/mol |
| Exact Mass | 906.42 |
| IUPAC Name | [2,2-bis(prop-2-enoyloxymethyl)-3-[3-prop-2-enoyloxy-2-(4-prop-2-enoyloxybutoxymethyl)-2-(6-prop-2-enoyloxyhexanoyloxymethyl)propoxy]propyl] 6-(3-oxopent-4-enoxy)hexanoate |
| SMILES | C=CC(=O)CCOCCCCCC(=O)OCC(COCC(COCCCCOC(=O)C=C)(COC(=O)C=C)COC(=O)CCCCCOC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C46H66O18/c1-7-37(47)23-28-55-24-17-13-15-21-44(54)64-36-46(34-61-41(51)11-5,35-62-42(52)12-6)31-57-30-45(32-60-40(50)10-4,29-56-25-19-20-27-59-39(49)9-3)33-63-43(53)22-16-14-18-26-58-38(48)8-2/h7-12H,1-6,13-36H2 |
| InChIKey | VMYWYHQLTILKAL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 228.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.02 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|