C29H40O12 — CID 170682322
bis[2-methyl-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] heptanedioate (PubChem CID 170682322) has the molecular formula C29H40O12 and a molecular weight of 580.63 g/mol. Its IUPAC name is bis[2-methyl-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] heptanedioate.
| Compound Name | bis[2-methyl-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] heptanedioate |
|---|---|
| PubChem CID | 170682322 |
| Molecular Formula | C29H40O12 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | bis[2-methyl-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] heptanedioate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)COC(=O)CCCCCC(=O)OCC(C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C29H40O12/c1-7-22(30)36-16-28(5,17-37-23(31)8-2)20-40-26(34)14-12-11-13-15-27(35)41-21-29(6,18-38-24(32)9-3)19-39-25(33)10-4/h7-10H,1-4,11-21H2,5-6H3 |
| InChIKey | JQZGUKWJNAPVFL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|