C40H58O16 — CID 176640441
[2,2-bis(6-prop-2-enoyloxyhexanoyloxymethyl)-3-(5-prop-2-enoyloxypentanoyloxy)propyl] 6-prop-2-enoyloxyhexanoate (PubChem CID 176640441) has the molecular formula C40H58O16 and a molecular weight of 794.89 g/mol. Its IUPAC name is [2,2-bis(6-prop-2-enoyloxyhexanoyloxymethyl)-3-(5-prop-2-enoyloxypentanoyloxy)propyl] 6-prop-2-enoyloxyhexanoate.
| Compound Name | [2,2-bis(6-prop-2-enoyloxyhexanoyloxymethyl)-3-(5-prop-2-enoyloxypentanoyloxy)propyl] 6-prop-2-enoyloxyhexanoate |
|---|---|
| PubChem CID | 176640441 |
| Molecular Formula | C40H58O16 |
| Molecular Weight | 794.89 g/mol |
| Exact Mass | 794.37 |
| IUPAC Name | [2,2-bis(6-prop-2-enoyloxyhexanoyloxymethyl)-3-(5-prop-2-enoyloxypentanoyloxy)propyl] 6-prop-2-enoyloxyhexanoate |
| SMILES | C=CC(=O)OCCCCCC(=O)OCC(COC(=O)CCCCCOC(=O)C=C)(COC(=O)CCCCCOC(=O)C=C)COC(=O)CCCCOC(=O)C=C |
| InChI | InChI=1S/C40H58O16/c1-5-32(41)49-24-16-9-12-20-36(45)53-28-40(31-56-39(48)23-15-19-27-52-35(44)8-4,29-54-37(46)21-13-10-17-25-50-33(42)6-2)30-55-38(47)22-14-11-18-26-51-34(43)7-3/h5-8H,1-4,9-31H2 |
| InChIKey | QOMHUZIVCGTXPW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|