C30H44O16 — CID 159615656
4-oxo-4-[6-oxo-6-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]hexoxy]butanoic acid;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid (PubChem CID 159615656) has the molecular formula C30H44O16 and a molecular weight of 660.67 g/mol. Its IUPAC name is 4-oxo-4-[6-oxo-6-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]hexoxy]butanoic acid;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid.
| Compound Name | 4-oxo-4-[6-oxo-6-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]hexoxy]butanoic acid;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid |
|---|---|
| PubChem CID | 159615656 |
| Molecular Formula | C30H44O16 |
| Molecular Weight | 660.67 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 4-oxo-4-[6-oxo-6-[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexoxy]hexoxy]butanoic acid;4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid |
| SMILES | C=CC(=O)OCCOC(=O)CCC(=O)O.C=CC(=O)OCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C21H32O10.C9H12O6/c1-2-18(24)30-15-16-31-20(26)10-6-4-7-13-28-19(25)9-5-3-8-14-29-21(27)12-11-17(22)23;1-2-8(12)14-5-6-15-9(13)4-3-7(10)11/h2H,1,3-16H2,(H,22,23);2H,1,3-6H2,(H,10,11) |
| InChIKey | MNGCZWBZSDETMA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 232.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|