C25H40N2O10 — CID 58050817
2-prop-2-enoyloxyethyl 6-[6-[3-oxo-3-[2-(propanoylamino)ethylamino]propanoyl]oxyhexanoyloxy]hexanoate (PubChem CID 58050817) has the molecular formula C25H40N2O10 and a molecular weight of 528.60 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 6-[6-[3-oxo-3-[2-(propanoylamino)ethylamino]propanoyl]oxyhexanoyloxy]hexanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 6-[6-[3-oxo-3-[2-(propanoylamino)ethylamino]propanoyl]oxyhexanoyloxy]hexanoate |
|---|---|
| PubChem CID | 58050817 |
| Molecular Formula | C25H40N2O10 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 6-[6-[3-oxo-3-[2-(propanoylamino)ethylamino]propanoyl]oxyhexanoyloxy]hexanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)CC(=O)NCCNC(=O)CC |
| InChI | InChI=1S/C25H40N2O10/c1-3-20(28)26-13-14-27-21(29)19-25(33)35-16-10-6-7-11-23(31)34-15-9-5-8-12-24(32)37-18-17-36-22(30)4-2/h4H,2-3,5-19H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | YVHMHAPFYQZAIR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|