C20H30N2O9 — CID 88932102
2-prop-2-enoyloxyethyl 6-[3-oxo-3-[2-(2-oxobutanoylamino)ethylamino]propanoyl]oxyhexanoate (PubChem CID 88932102) has the molecular formula C20H30N2O9 and a molecular weight of 442.47 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 6-[3-oxo-3-[2-(2-oxobutanoylamino)ethylamino]propanoyl]oxyhexanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 6-[3-oxo-3-[2-(2-oxobutanoylamino)ethylamino]propanoyl]oxyhexanoate |
|---|---|
| PubChem CID | 88932102 |
| Molecular Formula | C20H30N2O9 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 6-[3-oxo-3-[2-(2-oxobutanoylamino)ethylamino]propanoyl]oxyhexanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCOC(=O)CC(=O)NCCNC(=O)C(=O)CC |
| InChI | InChI=1S/C20H30N2O9/c1-3-15(23)20(28)22-10-9-21-16(24)14-19(27)29-11-7-5-6-8-18(26)31-13-12-30-17(25)4-2/h4H,2-3,5-14H2,1H3,(H,21,24)(H,22,28) |
| InChIKey | YEAPWAQAHYIVRP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|