C17H27NO7 — CID 59645598
2-prop-2-enoyloxyethyl 6-[3-oxo-3-(propylamino)propanoyl]oxyhexanoate (PubChem CID 59645598) has the molecular formula C17H27NO7 and a molecular weight of 357.40 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 6-[3-oxo-3-(propylamino)propanoyl]oxyhexanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 6-[3-oxo-3-(propylamino)propanoyl]oxyhexanoate |
|---|---|
| PubChem CID | 59645598 |
| Molecular Formula | C17H27NO7 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 6-[3-oxo-3-(propylamino)propanoyl]oxyhexanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCOC(=O)CC(=O)NCCC |
| InChI | InChI=1S/C17H27NO7/c1-3-9-18-14(19)13-17(22)23-10-7-5-6-8-16(21)25-12-11-24-15(20)4-2/h4H,2-3,5-13H2,1H3,(H,18,19) |
| InChIKey | MPWOELZOHJDQRP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|