C32H50N2O14 — CID 91006403
2-acetyloxyethyl prop-2-enoate;2-prop-2-enoyloxyethyl 6-[3-[2-[(3-hexoxy-3-oxopropanoyl)amino]ethylamino]-3-oxopropanoyl]oxyhexanoate (PubChem CID 91006403) has the molecular formula C32H50N2O14 and a molecular weight of 686.75 g/mol. Its IUPAC name is 2-acetyloxyethyl prop-2-enoate;2-prop-2-enoyloxyethyl 6-[3-[2-[(3-hexoxy-3-oxopropanoyl)amino]ethylamino]-3-oxopropanoyl]oxyhexanoate.
| Compound Name | 2-acetyloxyethyl prop-2-enoate;2-prop-2-enoyloxyethyl 6-[3-[2-[(3-hexoxy-3-oxopropanoyl)amino]ethylamino]-3-oxopropanoyl]oxyhexanoate |
|---|---|
| PubChem CID | 91006403 |
| Molecular Formula | C32H50N2O14 |
| Molecular Weight | 686.75 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | 2-acetyloxyethyl prop-2-enoate;2-prop-2-enoyloxyethyl 6-[3-[2-[(3-hexoxy-3-oxopropanoyl)amino]ethylamino]-3-oxopropanoyl]oxyhexanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCOC(=O)CC(=O)NCCNC(=O)CC(=O)OCCCCCC.C=CC(=O)OCCOC(C)=O |
| InChI | InChI=1S/C25H40N2O10.C7H10O4/c1-3-5-6-9-14-34-24(32)18-20(28)26-12-13-27-21(29)19-25(33)35-15-10-7-8-11-23(31)37-17-16-36-22(30)4-2;1-3-7(9)11-5-4-10-6(2)8/h4H,2-3,5-19H2,1H3,(H,26,28)(H,27,29);3H,1,4-5H2,2H3 |
| InChIKey | PTTPXJQJHWGJDA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 216.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.75 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|