About 2-acetyloxyethyl hexanoate
2-acetyloxyethyl hexanoate (PubChem CID 21336001) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-acetyloxyethyl hexanoate.
Molecular Properties
| Compound Name | 2-acetyloxyethyl hexanoate |
| PubChem CID | 21336001 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-acetyloxyethyl hexanoate |
| SMILES | CCCCCC(=O)OCCOC(C)=O |
| InChI | InChI=1S/C10H18O4/c1-3-4-5-6-10(12)14-8-7-13-9(2)11/h3-8H2,1-2H3 |
| InChIKey | WCYNTBVCUYFRSV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl hexanoate?
The IUPAC name of 2-acetyloxyethyl hexanoate (CID 21336001) is 2-acetyloxyethyl hexanoate.
What is the SMILES notation for 2-acetyloxyethyl hexanoate?
The canonical SMILES for 2-acetyloxyethyl hexanoate is CCCCCC(=O)OCCOC(C)=O.
What is the InChIKey of 2-acetyloxyethyl hexanoate?
The InChIKey is WCYNTBVCUYFRSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-3-4-5-6-10(12)14-8-7-13-9(2)11/h3-8H2,1-2H3.
What are the key properties of 2-acetyloxyethyl hexanoate?
2-acetyloxyethyl hexanoate has a molecular weight of 202.25 g/mol, XLogP of 1.67, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl hexanoate is sourced from PubChem (CID 21336001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).