About butyl hexanoate;ethyl acetate
butyl hexanoate;ethyl acetate (PubChem CID 160874959) has the molecular formula C14H28O4
and a molecular weight of 260.37 g/mol. Its IUPAC name is butyl hexanoate;ethyl acetate.
Molecular Properties
| Compound Name | butyl hexanoate;ethyl acetate |
| PubChem CID | 160874959 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | butyl hexanoate;ethyl acetate |
| SMILES | CCCCCC(=O)OCCCC.CCOC(C)=O |
| InChI | InChI=1S/C10H20O2.C4H8O2/c1-3-5-7-8-10(11)12-9-6-4-2;1-3-6-4(2)5/h3-9H2,1-2H3;3H2,1-2H3 |
| InChIKey | SMGQOBBRZOIQOW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl hexanoate;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl hexanoate;ethyl acetate?
The IUPAC name of butyl hexanoate;ethyl acetate (CID 160874959) is butyl hexanoate;ethyl acetate.
What is the SMILES notation for butyl hexanoate;ethyl acetate?
The canonical SMILES for butyl hexanoate;ethyl acetate is CCCCCC(=O)OCCCC.CCOC(C)=O.
What is the InChIKey of butyl hexanoate;ethyl acetate?
The InChIKey is SMGQOBBRZOIQOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C4H8O2/c1-3-5-7-8-10(11)12-9-6-4-2;1-3-6-4(2)5/h3-9H2,1-2H3;3H2,1-2H3.
What are the key properties of butyl hexanoate;ethyl acetate?
butyl hexanoate;ethyl acetate has a molecular weight of 260.37 g/mol, XLogP of 3.48, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl hexanoate;ethyl acetate is sourced from PubChem (CID 160874959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).