C31H42N2O13 — CID 59260405
2-prop-2-enoyloxyethyl 6-[3-[2-[[3-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoyl]oxyhexanoate (PubChem CID 59260405) has the molecular formula C31H42N2O13 and a molecular weight of 650.68 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 6-[3-[2-[[3-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoyl]oxyhexanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 6-[3-[2-[[3-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoyl]oxyhexanoate |
|---|---|
| PubChem CID | 59260405 |
| Molecular Formula | C31H42N2O13 |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 6-[3-[2-[[3-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoyl]oxyhexanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCOC(=O)CC(=O)NCCNC(=O)CC(=O)OCCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C31H42N2O13/c1-4-26(36)44-18-19-45-27(37)8-6-5-7-15-43-28(38)20-24(34)32-13-14-33-25(35)21-29(39)46-17-16-42-23-11-9-22(10-12-23)30(40)31(2,3)41/h4,9-12,41H,1,5-8,13-21H2,2-3H3,(H,32,34)(H,33,35) |
| InChIKey | ZNNBVLSFUKQVFB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 209.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|