C17H20O7 — CID 152542710
4-O-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 152542710) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is 4-O-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 152542710 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-O-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C17H20O7/c1-17(2,21)16(20)12-4-6-13(7-5-12)23-10-11-24-15(19)9-8-14(18)22-3/h4-9,21H,10-11H2,1-3H3/b9-8+ |
| InChIKey | YLWFKYUSLJEITQ-CMDGGOBGSA-N |
| XLogP | 1.29 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|