C24H30O6S2 — CID 162507967
2-hydroxy-1-[4-[2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyldisulfanyl]ethoxy]phenyl]-2-methylpropan-1-one (PubChem CID 162507967) has the molecular formula C24H30O6S2 and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-hydroxy-1-[4-[2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyldisulfanyl]ethoxy]phenyl]-2-methylpropan-1-one.
| Compound Name | 2-hydroxy-1-[4-[2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyldisulfanyl]ethoxy]phenyl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 162507967 |
| Molecular Formula | C24H30O6S2 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-hydroxy-1-[4-[2-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethyldisulfanyl]ethoxy]phenyl]-2-methylpropan-1-one |
| SMILES | CC(C)(O)C(=O)c1ccc(OCCSSCCOc2ccc(C(=O)C(C)(C)O)cc2)cc1 |
| InChI | InChI=1S/C24H30O6S2/c1-23(2,27)21(25)17-5-9-19(10-6-17)29-13-15-31-32-16-14-30-20-11-7-18(8-12-20)22(26)24(3,4)28/h5-12,27-28H,13-16H2,1-4H3 |
| InChIKey | SRKMOGWEXBGULE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|